C24H23N7S — CID 58300203
N-(5-piperazin-1-yl-2-pyridinyl)-8-(thiophen-3-ylmethyl)-4,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 58300203) has the molecular formula C24H23N7S and a molecular weight of 441.56 g/mol. Its IUPAC name is N-(5-piperazin-1-yl-2-pyridinyl)-8-(thiophen-3-ylmethyl)-4,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | N-(5-piperazin-1-yl-2-pyridinyl)-8-(thiophen-3-ylmethyl)-4,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 58300203 |
| Molecular Formula | C24H23N7S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-(5-piperazin-1-yl-2-pyridinyl)-8-(thiophen-3-ylmethyl)-4,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | c1cc2c3cnc(Nc4ccc(N5CCNCC5)cn4)cc3n(Cc3ccsc3)c2cn1 |
| InChI | InChI=1S/C24H23N7S/c1-2-23(27-12-18(1)30-8-6-25-7-9-30)29-24-11-21-20(13-28-24)19-3-5-26-14-22(19)31(21)15-17-4-10-32-16-17/h1-5,10-14,16,25H,6-9,15H2,(H,27,28,29) |
| InChIKey | YITZLEHWDLDKBR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |