C24H27N7 — CID 58300214
8-cyclopentyl-N-(4-piperazin-1-ylphenyl)-4,6,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 58300214) has the molecular formula C24H27N7 and a molecular weight of 413.53 g/mol. Its IUPAC name is 8-cyclopentyl-N-(4-piperazin-1-ylphenyl)-4,6,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | 8-cyclopentyl-N-(4-piperazin-1-ylphenyl)-4,6,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 58300214 |
| Molecular Formula | C24H27N7 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 8-cyclopentyl-N-(4-piperazin-1-ylphenyl)-4,6,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | c1cnc2c(c1)c1cnc(Nc3ccc(N4CCNCC4)cc3)nc1n2C1CCCC1 |
| InChI | InChI=1S/C24H27N7/c1-2-5-19(4-1)31-22-20(6-3-11-26-22)21-16-27-24(29-23(21)31)28-17-7-9-18(10-8-17)30-14-12-25-13-15-30/h3,6-11,16,19,25H,1-2,4-5,12-15H2,(H,27,28,29) |
| InChIKey | RHOCTZQICRQPCV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|