C40H30N4 — CID 58300561
2,6,11,15-tetraphenyl-4,13,19,20-tetrazatricyclo[14.2.1.17,10]icosa-1(18),2,4,6,8,10,12,14,16-nonaene (PubChem CID 58300561) has the molecular formula C40H30N4 and a molecular weight of 566.71 g/mol. Its IUPAC name is 2,6,11,15-tetraphenyl-4,13,19,20-tetrazatricyclo[14.2.1.17,10]icosa-1(18),2,4,6,8,10,12,14,16-nonaene.
| Compound Name | 2,6,11,15-tetraphenyl-4,13,19,20-tetrazatricyclo[14.2.1.17,10]icosa-1(18),2,4,6,8,10,12,14,16-nonaene |
|---|---|
| PubChem CID | 58300561 |
| Molecular Formula | C40H30N4 |
| Molecular Weight | 566.71 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | 2,6,11,15-tetraphenyl-4,13,19,20-tetrazatricyclo[14.2.1.17,10]icosa-1(18),2,4,6,8,10,12,14,16-nonaene |
| SMILES | c1ccc(-c2cncc(-c3ccccc3)c3ccc([nH]3)c(-c3ccccc3)cncc(-c3ccccc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C40H30N4/c1-5-13-29(14-6-1)33-25-41-26-34(30-15-7-2-8-16-30)39-23-24-40(44-39)36(32-19-11-4-12-20-32)28-42-27-35(31-17-9-3-10-18-31)38-22-21-37(33)43-38/h1-28,43-44H/b33-25-,34-26+,35-27-,36-28+,37-33+,38-35+,39-34-,40-36-,41-25-,41-26+,42-27-,42-28+ |
| InChIKey | VBPRWIFMVIZGHE-MPLMEJGYSA-N |
| XLogP | 10.36 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.71 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |