About 2-methyl-5-methylidene-3,4-dihydropyrrole-3,4-diol
2-methyl-5-methylidene-3,4-dihydropyrrole-3,4-diol (PubChem CID 58300563) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is 2-methyl-5-methylidene-3,4-dihydropyrrole-3,4-diol.
Molecular Properties
| Compound Name | 2-methyl-5-methylidene-3,4-dihydropyrrole-3,4-diol |
| PubChem CID | 58300563 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 2-methyl-5-methylidene-3,4-dihydropyrrole-3,4-diol |
| SMILES | C=C1N=C(C)C(O)C1O |
| InChI | InChI=1S/C6H9NO2/c1-3-5(8)6(9)4(2)7-3/h5-6,8-9H,1H2,2H3 |
| InChIKey | HQOPMEJOLZKTED-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-5-methylidene-3,4-dihydropyrrole-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-methylidene-3,4-dihydropyrrole-3,4-diol?
The IUPAC name of 2-methyl-5-methylidene-3,4-dihydropyrrole-3,4-diol (CID 58300563) is 2-methyl-5-methylidene-3,4-dihydropyrrole-3,4-diol.
What is the SMILES notation for 2-methyl-5-methylidene-3,4-dihydropyrrole-3,4-diol?
The canonical SMILES for 2-methyl-5-methylidene-3,4-dihydropyrrole-3,4-diol is C=C1N=C(C)C(O)C1O.
What is the InChIKey of 2-methyl-5-methylidene-3,4-dihydropyrrole-3,4-diol?
The InChIKey is HQOPMEJOLZKTED-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-3-5(8)6(9)4(2)7-3/h5-6,8-9H,1H2,2H3.
What are the key properties of 2-methyl-5-methylidene-3,4-dihydropyrrole-3,4-diol?
2-methyl-5-methylidene-3,4-dihydropyrrole-3,4-diol has a molecular weight of 127.14 g/mol, XLogP of -0.30, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-methylidene-3,4-dihydropyrrole-3,4-diol is sourced from PubChem (CID 58300563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).