C21H34N+ — CID 58300832
1-ethyl-1-methyl-3-(4-phenylbutyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-ium (PubChem CID 58300832) has the molecular formula C21H34N+ and a molecular weight of 300.51 g/mol. Its IUPAC name is 1-ethyl-1-methyl-3-(4-phenylbutyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-ium.
| Compound Name | 1-ethyl-1-methyl-3-(4-phenylbutyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-ium |
|---|---|
| PubChem CID | 58300832 |
| Molecular Formula | C21H34N+ |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | 1-ethyl-1-methyl-3-(4-phenylbutyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-ium |
| SMILES | CC[N+]1(C)CC(CCCCc2ccccc2)C2CCCCC21 |
| InChI | InChI=1S/C21H34N/c1-3-22(2)17-19(20-15-9-10-16-21(20)22)14-8-7-13-18-11-5-4-6-12-18/h4-6,11-12,19-21H,3,7-10,13-17H2,1-2H3/q+1 |
| InChIKey | KOHOJXSVLMQUNI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|