About 1-butyl-3-ethylimidazol-1-ium-4,5-diol
1-butyl-3-ethylimidazol-1-ium-4,5-diol (PubChem CID 58300876) has the molecular formula C9H17N2O2+
and a molecular weight of 185.25 g/mol. Its IUPAC name is 1-butyl-3-ethylimidazol-1-ium-4,5-diol.
Molecular Properties
| Compound Name | 1-butyl-3-ethylimidazol-1-ium-4,5-diol |
| PubChem CID | 58300876 |
| Molecular Formula | C9H17N2O2+ |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.13 |
| IUPAC Name | 1-butyl-3-ethylimidazol-1-ium-4,5-diol |
| SMILES | CCCC[n+]1cn(CC)c(O)c1O |
| InChI | InChI=1S/C9H16N2O2/c1-3-5-6-11-7-10(4-2)8(12)9(11)13/h7H,3-6H2,1-2H3,(H-,12,13)/p+1 |
| InChIKey | JUOSHJAWNXDKJL-UHFFFAOYSA-O |
| XLogP | 1.01 |
| TPSA | 49.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-ethylimidazol-1-ium-4,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-ethylimidazol-1-ium-4,5-diol?
The IUPAC name of 1-butyl-3-ethylimidazol-1-ium-4,5-diol (CID 58300876) is 1-butyl-3-ethylimidazol-1-ium-4,5-diol.
What is the SMILES notation for 1-butyl-3-ethylimidazol-1-ium-4,5-diol?
The canonical SMILES for 1-butyl-3-ethylimidazol-1-ium-4,5-diol is CCCC[n+]1cn(CC)c(O)c1O.
What is the InChIKey of 1-butyl-3-ethylimidazol-1-ium-4,5-diol?
The InChIKey is JUOSHJAWNXDKJL-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H16N2O2/c1-3-5-6-11-7-10(4-2)8(12)9(11)13/h7H,3-6H2,1-2H3,(H-,12,13)/p+1.
What are the key properties of 1-butyl-3-ethylimidazol-1-ium-4,5-diol?
1-butyl-3-ethylimidazol-1-ium-4,5-diol has a molecular weight of 185.25 g/mol, XLogP of 1.01, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-ethylimidazol-1-ium-4,5-diol is sourced from PubChem (CID 58300876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).