C14H6N4 — CID 58301272
2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)-2-isocyanoacetonitrile (PubChem CID 58301272) has the molecular formula C14H6N4 and a molecular weight of 230.23 g/mol. Its IUPAC name is 2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)-2-isocyanoacetonitrile.
| Compound Name | 2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 58301272 |
| Molecular Formula | C14H6N4 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1c2cccnc2-c2ncccc21 |
| InChI | InChI=1S/C14H6N4/c1-16-11(8-15)12-9-4-2-6-17-13(9)14-10(12)5-3-7-18-14/h2-7H |
| InChIKey | YHFSSTYJMBDXAQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 53.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|