About (2,6-dimethylcycloheptyl) sulfite
(2,6-dimethylcycloheptyl) sulfite (PubChem CID 58301323) has the molecular formula C9H17O3S-
and a molecular weight of 205.30 g/mol. Its IUPAC name is (2,6-dimethylcycloheptyl) sulfite.
Molecular Properties
| Compound Name | (2,6-dimethylcycloheptyl) sulfite |
| PubChem CID | 58301323 |
| Molecular Formula | C9H17O3S- |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | (2,6-dimethylcycloheptyl) sulfite |
| SMILES | CC1CCCC(C)C(OS(=O)[O-])C1 |
| InChI | InChI=1S/C9H18O3S/c1-7-4-3-5-8(2)9(6-7)12-13(10)11/h7-9H,3-6H2,1-2H3,(H,10,11)/p-1 |
| InChIKey | WMSMDHRKUDSRDF-UHFFFAOYSA-M |
| XLogP | 2.01 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (2,6-dimethylcycloheptyl) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethylcycloheptyl) sulfite?
The IUPAC name of (2,6-dimethylcycloheptyl) sulfite (CID 58301323) is (2,6-dimethylcycloheptyl) sulfite.
What is the SMILES notation for (2,6-dimethylcycloheptyl) sulfite?
The canonical SMILES for (2,6-dimethylcycloheptyl) sulfite is CC1CCCC(C)C(OS(=O)[O-])C1.
What is the InChIKey of (2,6-dimethylcycloheptyl) sulfite?
The InChIKey is WMSMDHRKUDSRDF-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H18O3S/c1-7-4-3-5-8(2)9(6-7)12-13(10)11/h7-9H,3-6H2,1-2H3,(H,10,11)/p-1.
What are the key properties of (2,6-dimethylcycloheptyl) sulfite?
(2,6-dimethylcycloheptyl) sulfite has a molecular weight of 205.30 g/mol, XLogP of 2.01, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethylcycloheptyl) sulfite is sourced from PubChem (CID 58301323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).