C7H12BrFO — CID 58302150
(4R,5R)-2-bromo-5-ethyl-3-fluoro-4-methyloxolane (PubChem CID 58302150) has the molecular formula C7H12BrFO and a molecular weight of 211.07 g/mol. Its IUPAC name is (4R,5R)-2-bromo-5-ethyl-3-fluoro-4-methyloxolane.
| Compound Name | (4R,5R)-2-bromo-5-ethyl-3-fluoro-4-methyloxolane |
|---|---|
| PubChem CID | 58302150 |
| Molecular Formula | C7H12BrFO |
| Molecular Weight | 211.07 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | (4R,5R)-2-bromo-5-ethyl-3-fluoro-4-methyloxolane |
| SMILES | CC[C@H]1OC(Br)C(F)[C@@H]1C |
| InChI | InChI=1S/C7H12BrFO/c1-3-5-4(2)6(9)7(8)10-5/h4-7H,3H2,1-2H3/t4-,5-,6?,7?/m1/s1 |
| InChIKey | IGYSUUMHVBWZLI-HCRKAXIXSA-N |
| XLogP | 2.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.07 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|