C5HF9 — CID 583022
1,1,2,2,3,3,4,4,5-nonafluorocyclopentane (PubChem CID 583022) has the molecular formula C5HF9 and a molecular weight of 232.04 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5-nonafluorocyclopentane.
| Compound Name | 1,1,2,2,3,3,4,4,5-nonafluorocyclopentane |
|---|---|
| PubChem CID | 583022 |
| Molecular Formula | C5HF9 |
| Molecular Weight | 232.04 g/mol |
| Exact Mass | 231.99 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5-nonafluorocyclopentane |
| SMILES | FC1C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C5HF9/c6-1-2(7,8)4(11,12)5(13,14)3(1,9)10/h1H |
| InChIKey | SOJZMJXWEOBDIC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.04 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|