About 2-(5-benzylsulfonyl-1,3,4-thiadiazol-2-yl)-1-(2-methoxyphenyl)ethanone
2-(5-benzylsulfonyl-1,3,4-thiadiazol-2-yl)-1-(2-methoxyphenyl)ethanone (PubChem CID 58302561) has the molecular formula C18H16N2O4S2
and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-(5-benzylsulfonyl-1,3,4-thiadiazol-2-yl)-1-(2-methoxyphenyl)ethanone.
Molecular Properties
| Compound Name | 2-(5-benzylsulfonyl-1,3,4-thiadiazol-2-yl)-1-(2-methoxyphenyl)ethanone |
| PubChem CID | 58302561 |
| Molecular Formula | C18H16N2O4S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 2-(5-benzylsulfonyl-1,3,4-thiadiazol-2-yl)-1-(2-methoxyphenyl)ethanone |
| SMILES | COc1ccccc1C(=O)Cc1nnc(S(=O)(=O)Cc2ccccc2)s1 |
| InChI | InChI=1S/C18H16N2O4S2/c1-24-16-10-6-5-9-14(16)15(21)11-17-19-20-18(25-17)26(22,23)12-13-7-3-2-4-8-13/h2-10H,11-12H2,1H3 |
| InChIKey | SOMWRCRYQQBEPP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(5-benzylsulfonyl-1,3,4-thiadiazol-2-yl)-1-(2-methoxyphenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-benzylsulfonyl-1,3,4-thiadiazol-2-yl)-1-(2-methoxyphenyl)ethanone?
The IUPAC name of 2-(5-benzylsulfonyl-1,3,4-thiadiazol-2-yl)-1-(2-methoxyphenyl)ethanone (CID 58302561) is 2-(5-benzylsulfonyl-1,3,4-thiadiazol-2-yl)-1-(2-methoxyphenyl)ethanone.
What is the SMILES notation for 2-(5-benzylsulfonyl-1,3,4-thiadiazol-2-yl)-1-(2-methoxyphenyl)ethanone?
The canonical SMILES for 2-(5-benzylsulfonyl-1,3,4-thiadiazol-2-yl)-1-(2-methoxyphenyl)ethanone is COc1ccccc1C(=O)Cc1nnc(S(=O)(=O)Cc2ccccc2)s1.
What is the InChIKey of 2-(5-benzylsulfonyl-1,3,4-thiadiazol-2-yl)-1-(2-methoxyphenyl)ethanone?
The InChIKey is SOMWRCRYQQBEPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O4S2/c1-24-16-10-6-5-9-14(16)15(21)11-17-19-20-18(25-17)26(22,23)12-13-7-3-2-4-8-13/h2-10H,11-12H2,1H3.
What are the key properties of 2-(5-benzylsulfonyl-1,3,4-thiadiazol-2-yl)-1-(2-methoxyphenyl)ethanone?
2-(5-benzylsulfonyl-1,3,4-thiadiazol-2-yl)-1-(2-methoxyphenyl)ethanone has a molecular weight of 388.47 g/mol, XLogP of 2.95, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-benzylsulfonyl-1,3,4-thiadiazol-2-yl)-1-(2-methoxyphenyl)ethanone is sourced from PubChem (CID 58302561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).