C21H16FN5O — CID 58302796
1-(2-fluorophenyl)-3-[3-(4-pyridin-4-yl-1H-pyrazol-5-yl)phenyl]urea (PubChem CID 58302796) has the molecular formula C21H16FN5O and a molecular weight of 373.39 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[3-(4-pyridin-4-yl-1H-pyrazol-5-yl)phenyl]urea.
| Compound Name | 1-(2-fluorophenyl)-3-[3-(4-pyridin-4-yl-1H-pyrazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 58302796 |
| Molecular Formula | C21H16FN5O |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[3-(4-pyridin-4-yl-1H-pyrazol-5-yl)phenyl]urea |
| SMILES | O=C(Nc1cccc(-c2[nH]ncc2-c2ccncc2)c1)Nc1ccccc1F |
| InChI | InChI=1S/C21H16FN5O/c22-18-6-1-2-7-19(18)26-21(28)25-16-5-3-4-15(12-16)20-17(13-24-27-20)14-8-10-23-11-9-14/h1-13H,(H,24,27)(H2,25,26,28) |
| InChIKey | FAKJEGIJYRGKSO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |