C10H18N2 — CID 58302942
1,2,3,4,5,6-hexamethylpyridazine (PubChem CID 58302942) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexamethylpyridazine.
| Compound Name | 1,2,3,4,5,6-hexamethylpyridazine |
|---|---|
| PubChem CID | 58302942 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1,2,3,4,5,6-hexamethylpyridazine |
| SMILES | CC1=C(C)N(C)N(C)C(C)=C1C |
| InChI | InChI=1S/C10H18N2/c1-7-8(2)10(4)12(6)11(5)9(7)3/h1-6H3 |
| InChIKey | QGHDYLQVRGSRCZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |