About 1-methylfuro[2,3-d]imidazole
1-methylfuro[2,3-d]imidazole (PubChem CID 58303206) has the molecular formula C6H6N2O
and a molecular weight of 122.13 g/mol. Its IUPAC name is 1-methylfuro[2,3-d]imidazole.
Molecular Properties
| Compound Name | 1-methylfuro[2,3-d]imidazole |
| PubChem CID | 58303206 |
| Molecular Formula | C6H6N2O |
| Molecular Weight | 122.13 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | 1-methylfuro[2,3-d]imidazole |
| SMILES | Cn1cnc2occc21 |
| InChI | InChI=1S/C6H6N2O/c1-8-4-7-6-5(8)2-3-9-6/h2-4H,1H3 |
| InChIKey | HTLFQPBPHXVTGO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.13 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylfuro[2,3-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylfuro[2,3-d]imidazole?
The IUPAC name of 1-methylfuro[2,3-d]imidazole (CID 58303206) is 1-methylfuro[2,3-d]imidazole.
What is the SMILES notation for 1-methylfuro[2,3-d]imidazole?
The canonical SMILES for 1-methylfuro[2,3-d]imidazole is Cn1cnc2occc21.
What is the InChIKey of 1-methylfuro[2,3-d]imidazole?
The InChIKey is HTLFQPBPHXVTGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O/c1-8-4-7-6-5(8)2-3-9-6/h2-4H,1H3.
What are the key properties of 1-methylfuro[2,3-d]imidazole?
1-methylfuro[2,3-d]imidazole has a molecular weight of 122.13 g/mol, XLogP of 1.17, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylfuro[2,3-d]imidazole is sourced from PubChem (CID 58303206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).