About tert-butyl (2S,4S)-2-(ethoxymethyl)-4-(oxan-2-yloxy)pyrrolidine-1-carboxylate
tert-butyl (2S,4S)-2-(ethoxymethyl)-4-(oxan-2-yloxy)pyrrolidine-1-carboxylate (PubChem CID 58303301) has the molecular formula C17H31NO5
and a molecular weight of 329.44 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-(ethoxymethyl)-4-(oxan-2-yloxy)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S,4S)-2-(ethoxymethyl)-4-(oxan-2-yloxy)pyrrolidine-1-carboxylate |
| PubChem CID | 58303301 |
| Molecular Formula | C17H31NO5 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | tert-butyl (2S,4S)-2-(ethoxymethyl)-4-(oxan-2-yloxy)pyrrolidine-1-carboxylate |
| SMILES | CCOC[C@@H]1C[C@H](OC2CCCCO2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31NO5/c1-5-20-12-13-10-14(22-15-8-6-7-9-21-15)11-18(13)16(19)23-17(2,3)4/h13-15H,5-12H2,1-4H3/t13-,14-,15?/m0/s1 |
| InChIKey | MIAJZRKCYZAQFB-ZYOSVBKOSA-N |
| XLogP | 2.94 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl (2S,4S)-2-(ethoxymethyl)-4-(oxan-2-yloxy)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S,4S)-2-(ethoxymethyl)-4-(oxan-2-yloxy)pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2S,4S)-2-(ethoxymethyl)-4-(oxan-2-yloxy)pyrrolidine-1-carboxylate (CID 58303301) is tert-butyl (2S,4S)-2-(ethoxymethyl)-4-(oxan-2-yloxy)pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S,4S)-2-(ethoxymethyl)-4-(oxan-2-yloxy)pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S,4S)-2-(ethoxymethyl)-4-(oxan-2-yloxy)pyrrolidine-1-carboxylate is CCOC[C@@H]1C[C@H](OC2CCCCO2)CN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2S,4S)-2-(ethoxymethyl)-4-(oxan-2-yloxy)pyrrolidine-1-carboxylate?
The InChIKey is MIAJZRKCYZAQFB-ZYOSVBKOSA-N. The full InChI is InChI=1S/C17H31NO5/c1-5-20-12-13-10-14(22-15-8-6-7-9-21-15)11-18(13)16(19)23-17(2,3)4/h13-15H,5-12H2,1-4H3/t13-,14-,15?/m0/s1.
What are the key properties of tert-butyl (2S,4S)-2-(ethoxymethyl)-4-(oxan-2-yloxy)pyrrolidine-1-carboxylate?
tert-butyl (2S,4S)-2-(ethoxymethyl)-4-(oxan-2-yloxy)pyrrolidine-1-carboxylate has a molecular weight of 329.44 g/mol, XLogP of 2.94, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S,4S)-2-(ethoxymethyl)-4-(oxan-2-yloxy)pyrrolidine-1-carboxylate is sourced from PubChem (CID 58303301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).