About 5-(2,2-difluoroethoxy)-2-(2-trimethylsilylethynyl)pyrazin-1-ium-1-amine
5-(2,2-difluoroethoxy)-2-(2-trimethylsilylethynyl)pyrazin-1-ium-1-amine (PubChem CID 58303525) has the molecular formula C11H16F2N3OSi+
and a molecular weight of 272.35 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxy)-2-(2-trimethylsilylethynyl)pyrazin-1-ium-1-amine.
Molecular Properties
| Compound Name | 5-(2,2-difluoroethoxy)-2-(2-trimethylsilylethynyl)pyrazin-1-ium-1-amine |
| PubChem CID | 58303525 |
| Molecular Formula | C11H16F2N3OSi+ |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 5-(2,2-difluoroethoxy)-2-(2-trimethylsilylethynyl)pyrazin-1-ium-1-amine |
| SMILES | C[Si](C)(C)C#Cc1cnc(OCC(F)F)c[n+]1N |
| InChI | InChI=1S/C11H16F2N3OSi/c1-18(2,3)5-4-9-6-15-11(7-16(9)14)17-8-10(12)13/h6-7,10H,8H2,1-3H3,(H2,14,15)/q+1 |
| InChIKey | JSXYQELHEVLNPK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2-difluoroethoxy)-2-(2-trimethylsilylethynyl)pyrazin-1-ium-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-difluoroethoxy)-2-(2-trimethylsilylethynyl)pyrazin-1-ium-1-amine?
The IUPAC name of 5-(2,2-difluoroethoxy)-2-(2-trimethylsilylethynyl)pyrazin-1-ium-1-amine (CID 58303525) is 5-(2,2-difluoroethoxy)-2-(2-trimethylsilylethynyl)pyrazin-1-ium-1-amine.
What is the SMILES notation for 5-(2,2-difluoroethoxy)-2-(2-trimethylsilylethynyl)pyrazin-1-ium-1-amine?
The canonical SMILES for 5-(2,2-difluoroethoxy)-2-(2-trimethylsilylethynyl)pyrazin-1-ium-1-amine is C[Si](C)(C)C#Cc1cnc(OCC(F)F)c[n+]1N.
What is the InChIKey of 5-(2,2-difluoroethoxy)-2-(2-trimethylsilylethynyl)pyrazin-1-ium-1-amine?
The InChIKey is JSXYQELHEVLNPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F2N3OSi/c1-18(2,3)5-4-9-6-15-11(7-16(9)14)17-8-10(12)13/h6-7,10H,8H2,1-3H3,(H2,14,15)/q+1.
What are the key properties of 5-(2,2-difluoroethoxy)-2-(2-trimethylsilylethynyl)pyrazin-1-ium-1-amine?
5-(2,2-difluoroethoxy)-2-(2-trimethylsilylethynyl)pyrazin-1-ium-1-amine has a molecular weight of 272.35 g/mol, XLogP of 0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluoroethoxy)-2-(2-trimethylsilylethynyl)pyrazin-1-ium-1-amine is sourced from PubChem (CID 58303525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).