C27H26F4N2O — CID 58303902
2-(1-ethyl-6-fluoro-4-phenylmethoxyindol-3-yl)-N-[[3-(trifluoromethyl)phenyl]methyl]ethanamine (PubChem CID 58303902) has the molecular formula C27H26F4N2O and a molecular weight of 470.51 g/mol. Its IUPAC name is 2-(1-ethyl-6-fluoro-4-phenylmethoxyindol-3-yl)-N-[[3-(trifluoromethyl)phenyl]methyl]ethanamine.
| Compound Name | 2-(1-ethyl-6-fluoro-4-phenylmethoxyindol-3-yl)-N-[[3-(trifluoromethyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 58303902 |
| Molecular Formula | C27H26F4N2O |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 2-(1-ethyl-6-fluoro-4-phenylmethoxyindol-3-yl)-N-[[3-(trifluoromethyl)phenyl]methyl]ethanamine |
| SMILES | CCn1cc(CCNCc2cccc(C(F)(F)F)c2)c2c(OCc3ccccc3)cc(F)cc21 |
| InChI | InChI=1S/C27H26F4N2O/c1-2-33-17-21(11-12-32-16-20-9-6-10-22(13-20)27(29,30)31)26-24(33)14-23(28)15-25(26)34-18-19-7-4-3-5-8-19/h3-10,13-15,17,32H,2,11-12,16,18H2,1H3 |
| InChIKey | VUWZBXSOTBHVLW-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|