About 2,3-ditert-butyl-4H-1,4-benzoxazepin-5-one
2,3-ditert-butyl-4H-1,4-benzoxazepin-5-one (PubChem CID 58303933) has the molecular formula C17H23NO2
and a molecular weight of 273.38 g/mol. Its IUPAC name is 2,3-ditert-butyl-4H-1,4-benzoxazepin-5-one.
Molecular Properties
| Compound Name | 2,3-ditert-butyl-4H-1,4-benzoxazepin-5-one |
| PubChem CID | 58303933 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 2,3-ditert-butyl-4H-1,4-benzoxazepin-5-one |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)Oc2ccccc2C(=O)N1 |
| InChI | InChI=1S/C17H23NO2/c1-16(2,3)13-14(17(4,5)6)20-12-10-8-7-9-11(12)15(19)18-13/h7-10H,1-6H3,(H,18,19) |
| InChIKey | APLUZFGGPNGZEJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-ditert-butyl-4H-1,4-benzoxazepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-ditert-butyl-4H-1,4-benzoxazepin-5-one?
The IUPAC name of 2,3-ditert-butyl-4H-1,4-benzoxazepin-5-one (CID 58303933) is 2,3-ditert-butyl-4H-1,4-benzoxazepin-5-one.
What is the SMILES notation for 2,3-ditert-butyl-4H-1,4-benzoxazepin-5-one?
The canonical SMILES for 2,3-ditert-butyl-4H-1,4-benzoxazepin-5-one is CC(C)(C)C1=C(C(C)(C)C)Oc2ccccc2C(=O)N1.
What is the InChIKey of 2,3-ditert-butyl-4H-1,4-benzoxazepin-5-one?
The InChIKey is APLUZFGGPNGZEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO2/c1-16(2,3)13-14(17(4,5)6)20-12-10-8-7-9-11(12)15(19)18-13/h7-10H,1-6H3,(H,18,19).
What are the key properties of 2,3-ditert-butyl-4H-1,4-benzoxazepin-5-one?
2,3-ditert-butyl-4H-1,4-benzoxazepin-5-one has a molecular weight of 273.38 g/mol, XLogP of 4.11, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-ditert-butyl-4H-1,4-benzoxazepin-5-one is sourced from PubChem (CID 58303933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).