C16H20F3N3O3 — CID 58304160
tert-butyl N-[(4R)-4-(5-amino-2-fluorophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-yl]carbamate (PubChem CID 58304160) has the molecular formula C16H20F3N3O3 and a molecular weight of 359.35 g/mol. Its IUPAC name is tert-butyl N-[(4R)-4-(5-amino-2-fluorophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4R)-4-(5-amino-2-fluorophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-yl]carbamate |
|---|---|
| PubChem CID | 58304160 |
| Molecular Formula | C16H20F3N3O3 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | tert-butyl N-[(4R)-4-(5-amino-2-fluorophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=N[C@](C)(c2cc(N)ccc2F)C(F)(F)CO1 |
| InChI | InChI=1S/C16H20F3N3O3/c1-14(2,3)25-13(23)21-12-22-15(4,16(18,19)8-24-12)10-7-9(20)5-6-11(10)17/h5-7H,8,20H2,1-4H3,(H,21,22,23)/t15-/m1/s1 |
| InChIKey | GEDHUTOAXWTSJJ-OAHLLOKOSA-N |
| XLogP | 3.17 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|