C11H9F4N3O3 — CID 58304184
(4R)-4-(2,3-difluoro-5-nitrophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine (PubChem CID 58304184) has the molecular formula C11H9F4N3O3 and a molecular weight of 307.20 g/mol. Its IUPAC name is (4R)-4-(2,3-difluoro-5-nitrophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine.
| Compound Name | (4R)-4-(2,3-difluoro-5-nitrophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine |
|---|---|
| PubChem CID | 58304184 |
| Molecular Formula | C11H9F4N3O3 |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | (4R)-4-(2,3-difluoro-5-nitrophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine |
| SMILES | C[C@]1(c2cc([N+](=O)[O-])cc(F)c2F)N=C(N)OCC1(F)F |
| InChI | InChI=1S/C11H9F4N3O3/c1-10(11(14,15)4-21-9(16)17-10)6-2-5(18(19)20)3-7(12)8(6)13/h2-3H,4H2,1H3,(H2,16,17)/t10-/m1/s1 |
| InChIKey | XCNDKPYZNURBQO-SNVBAGLBSA-N |
| XLogP | 2.07 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|