About (4R)-4-(3-aminophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine
(4R)-4-(3-aminophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine (PubChem CID 58304186) has the molecular formula C11H13F2N3O
and a molecular weight of 241.24 g/mol. Its IUPAC name is (4R)-4-(3-aminophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine.
Molecular Properties
| Compound Name | (4R)-4-(3-aminophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine |
| PubChem CID | 58304186 |
| Molecular Formula | C11H13F2N3O |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | (4R)-4-(3-aminophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine |
| SMILES | C[C@]1(c2cccc(N)c2)N=C(N)OCC1(F)F |
| InChI | InChI=1S/C11H13F2N3O/c1-10(7-3-2-4-8(14)5-7)11(12,13)6-17-9(15)16-10/h2-5H,6,14H2,1H3,(H2,15,16)/t10-/m1/s1 |
| InChIKey | HLTZKYFVTJRRAW-SNVBAGLBSA-N |
| XLogP | 1.46 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-(3-aminophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-(3-aminophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine?
The IUPAC name of (4R)-4-(3-aminophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine (CID 58304186) is (4R)-4-(3-aminophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine.
What is the SMILES notation for (4R)-4-(3-aminophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine?
The canonical SMILES for (4R)-4-(3-aminophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine is C[C@]1(c2cccc(N)c2)N=C(N)OCC1(F)F.
What is the InChIKey of (4R)-4-(3-aminophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine?
The InChIKey is HLTZKYFVTJRRAW-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H13F2N3O/c1-10(7-3-2-4-8(14)5-7)11(12,13)6-17-9(15)16-10/h2-5H,6,14H2,1H3,(H2,15,16)/t10-/m1/s1.
What are the key properties of (4R)-4-(3-aminophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine?
(4R)-4-(3-aminophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine has a molecular weight of 241.24 g/mol, XLogP of 1.46, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-(3-aminophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine is sourced from PubChem (CID 58304186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).