C14H18F4N2O4S — CID 58304247
tert-butyl-[[(2R)-2-(2,3-difluoro-5-nitrophenyl)-3,3-difluoro-4-hydroxybutan-2-yl]amino]-oxidosulfanium (PubChem CID 58304247) has the molecular formula C14H18F4N2O4S and a molecular weight of 386.37 g/mol. Its IUPAC name is tert-butyl-[[(2R)-2-(2,3-difluoro-5-nitrophenyl)-3,3-difluoro-4-hydroxybutan-2-yl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(2R)-2-(2,3-difluoro-5-nitrophenyl)-3,3-difluoro-4-hydroxybutan-2-yl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 58304247 |
| Molecular Formula | C14H18F4N2O4S |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | tert-butyl-[[(2R)-2-(2,3-difluoro-5-nitrophenyl)-3,3-difluoro-4-hydroxybutan-2-yl]amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@](C)(c1cc([N+](=O)[O-])cc(F)c1F)C(F)(F)CO |
| InChI | InChI=1S/C14H18F4N2O4S/c1-12(2,3)25(24)19-13(4,14(17,18)7-21)9-5-8(20(22)23)6-10(15)11(9)16/h5-6,19,21H,7H2,1-4H3/t13-,25?/m1/s1 |
| InChIKey | ZSYVOMHJTCLVNN-POIHQHRPSA-N |
| XLogP | 2.77 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|