C11H11F3IN3O — CID 58304250
(4R)-4-(5-amino-2-fluoro-4-iodophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine (PubChem CID 58304250) has the molecular formula C11H11F3IN3O and a molecular weight of 385.13 g/mol. Its IUPAC name is (4R)-4-(5-amino-2-fluoro-4-iodophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine.
| Compound Name | (4R)-4-(5-amino-2-fluoro-4-iodophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine |
|---|---|
| PubChem CID | 58304250 |
| Molecular Formula | C11H11F3IN3O |
| Molecular Weight | 385.13 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | (4R)-4-(5-amino-2-fluoro-4-iodophenyl)-5,5-difluoro-4-methyl-6H-1,3-oxazin-2-amine |
| SMILES | C[C@]1(c2cc(N)c(I)cc2F)N=C(N)OCC1(F)F |
| InChI | InChI=1S/C11H11F3IN3O/c1-10(11(13,14)4-19-9(17)18-10)5-2-8(16)7(15)3-6(5)12/h2-3H,4,16H2,1H3,(H2,17,18)/t10-/m1/s1 |
| InChIKey | TVBHXRMDVBEBBU-SNVBAGLBSA-N |
| XLogP | 2.21 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.13 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|