C12H13FN2O2 — CID 58304309
(4aS,7aS)-7a-(2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-amine (PubChem CID 58304309) has the molecular formula C12H13FN2O2 and a molecular weight of 236.25 g/mol. Its IUPAC name is (4aS,7aS)-7a-(2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-amine.
| Compound Name | (4aS,7aS)-7a-(2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-amine |
|---|---|
| PubChem CID | 58304309 |
| Molecular Formula | C12H13FN2O2 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (4aS,7aS)-7a-(2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-amine |
| SMILES | NC1=N[C@@]2(c3ccccc3F)COC[C@H]2CO1 |
| InChI | InChI=1S/C12H13FN2O2/c13-10-4-2-1-3-9(10)12-7-16-5-8(12)6-17-11(14)15-12/h1-4,8H,5-7H2,(H2,14,15)/t8-,12-/m0/s1 |
| InChIKey | ZEAMKUXWEFVXDO-UFBFGSQYSA-N |
| XLogP | 1.01 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |