C13H23FO — CID 58304355
(3S,4E,6S,7Z)-5-fluoro-2,3-dimethylundeca-4,7-dien-6-ol (PubChem CID 58304355) has the molecular formula C13H23FO and a molecular weight of 214.32 g/mol. Its IUPAC name is (3S,4E,6S,7Z)-5-fluoro-2,3-dimethylundeca-4,7-dien-6-ol.
| Compound Name | (3S,4E,6S,7Z)-5-fluoro-2,3-dimethylundeca-4,7-dien-6-ol |
|---|---|
| PubChem CID | 58304355 |
| Molecular Formula | C13H23FO |
| Molecular Weight | 214.32 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (3S,4E,6S,7Z)-5-fluoro-2,3-dimethylundeca-4,7-dien-6-ol |
| SMILES | CCC/C=C\[C@H](O)/C(F)=C\[C@@H](C)C(C)C |
| InChI | InChI=1S/C13H23FO/c1-5-6-7-8-13(15)12(14)9-11(4)10(2)3/h7-11,13,15H,5-6H2,1-4H3/b8-7-,12-9+/t11-,13+/m1/s1 |
| InChIKey | UWHAZFZUAHYGFU-PCJRBHTFSA-N |
| XLogP | 3.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|