C21H24O6 — CID 58304382
(4S,8R,9Z,12S,13S,15E)-12,13,21-trihydroxy-19-methyl-3-oxatricyclo[15.4.0.04,8]henicosa-1(17),9,15,18,20-pentaene-2,11-dione (PubChem CID 58304382) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is (4S,8R,9Z,12S,13S,15E)-12,13,21-trihydroxy-19-methyl-3-oxatricyclo[15.4.0.04,8]henicosa-1(17),9,15,18,20-pentaene-2,11-dione.
| Compound Name | (4S,8R,9Z,12S,13S,15E)-12,13,21-trihydroxy-19-methyl-3-oxatricyclo[15.4.0.04,8]henicosa-1(17),9,15,18,20-pentaene-2,11-dione |
|---|---|
| PubChem CID | 58304382 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (4S,8R,9Z,12S,13S,15E)-12,13,21-trihydroxy-19-methyl-3-oxatricyclo[15.4.0.04,8]henicosa-1(17),9,15,18,20-pentaene-2,11-dione |
| SMILES | Cc1cc(O)c2c(c1)/C=C/C[C@H](O)[C@H](O)C(=O)/C=C\[C@H]1CCC[C@@H]1OC2=O |
| InChI | InChI=1S/C21H24O6/c1-12-10-14-5-2-6-15(22)20(25)16(23)9-8-13-4-3-7-18(13)27-21(26)19(14)17(24)11-12/h2,5,8-11,13,15,18,20,22,24-25H,3-4,6-7H2,1H3/b5-2+,9-8-/t13-,15+,18+,20+/m1/s1 |
| InChIKey | QQHMBUBVTHELBP-UVQTULPCSA-N |
| XLogP | 2.29 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |