C27H36O5 — CID 58304439
(2E,5S,10R,11Z,13R,14S)-7,7,10,13,14,18-hexamethyl-20-prop-2-enoxy-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one (PubChem CID 58304439) has the molecular formula C27H36O5 and a molecular weight of 440.58 g/mol. Its IUPAC name is (2E,5S,10R,11Z,13R,14S)-7,7,10,13,14,18-hexamethyl-20-prop-2-enoxy-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one.
| Compound Name | (2E,5S,10R,11Z,13R,14S)-7,7,10,13,14,18-hexamethyl-20-prop-2-enoxy-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one |
|---|---|
| PubChem CID | 58304439 |
| Molecular Formula | C27H36O5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | (2E,5S,10R,11Z,13R,14S)-7,7,10,13,14,18-hexamethyl-20-prop-2-enoxy-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one |
| SMILES | C=CCOc1cc(C)c2c(c1)/C=C/C[C@@H]1OC(C)(C)OC1[C@H](C)/C=C\[C@@H](C)[C@H](C)OC2=O |
| InChI | InChI=1S/C27H36O5/c1-8-14-29-22-15-19(4)24-21(16-22)10-9-11-23-25(32-27(6,7)31-23)18(3)13-12-17(2)20(5)30-26(24)28/h8-10,12-13,15-18,20,23,25H,1,11,14H2,2-7H3/b10-9+,13-12-/t17-,18-,20+,23+,25?/m1/s1 |
| InChIKey | AXQNUALGUJIZPQ-TXTWARJXSA-N |
| XLogP | 5.87 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|