C23H36O5Si — CID 58304554
2-trimethylsilylethyl 2-[(E,5S)-5-(2-hydroxypropan-2-yloxy)-6-oxohex-1-enyl]-4,6-dimethylbenzoate (PubChem CID 58304554) has the molecular formula C23H36O5Si and a molecular weight of 420.62 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[(E,5S)-5-(2-hydroxypropan-2-yloxy)-6-oxohex-1-enyl]-4,6-dimethylbenzoate.
| Compound Name | 2-trimethylsilylethyl 2-[(E,5S)-5-(2-hydroxypropan-2-yloxy)-6-oxohex-1-enyl]-4,6-dimethylbenzoate |
|---|---|
| PubChem CID | 58304554 |
| Molecular Formula | C23H36O5Si |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 2-trimethylsilylethyl 2-[(E,5S)-5-(2-hydroxypropan-2-yloxy)-6-oxohex-1-enyl]-4,6-dimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OCC[Si](C)(C)C)c(/C=C/CC[C@@H](C=O)OC(C)(C)O)c1 |
| InChI | InChI=1S/C23H36O5Si/c1-17-14-18(2)21(22(25)27-12-13-29(5,6)7)19(15-17)10-8-9-11-20(16-24)28-23(3,4)26/h8,10,14-16,20,26H,9,11-13H2,1-7H3/b10-8+/t20-/m0/s1 |
| InChIKey | KIIWXHDNIYTQFL-MFUYTVRRSA-N |
| XLogP | 4.90 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|