C16H27FO3 — CID 58304617
2-[(4S,5R)-5-[(E,2S,5S)-3-fluoro-5,6-dimethylhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde (PubChem CID 58304617) has the molecular formula C16H27FO3 and a molecular weight of 286.39 g/mol. Its IUPAC name is 2-[(4S,5R)-5-[(E,2S,5S)-3-fluoro-5,6-dimethylhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde.
| Compound Name | 2-[(4S,5R)-5-[(E,2S,5S)-3-fluoro-5,6-dimethylhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 58304617 |
| Molecular Formula | C16H27FO3 |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 2-[(4S,5R)-5-[(E,2S,5S)-3-fluoro-5,6-dimethylhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
| SMILES | CC(C)[C@H](C)/C=C(/F)[C@@H](C)[C@H]1OC(C)(C)O[C@H]1CC=O |
| InChI | InChI=1S/C16H27FO3/c1-10(2)11(3)9-13(17)12(4)15-14(7-8-18)19-16(5,6)20-15/h8-12,14-15H,7H2,1-6H3/b13-9+/t11-,12-,14+,15-/m1/s1 |
| InChIKey | ARQJDNHJTFUXIN-VCQUXFRKSA-N |
| XLogP | 3.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|