C23H38O5 — CID 58304661
(14S)-10-hydroxy-7,7,14,18,20-pentamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicos-19-en-16-one (PubChem CID 58304661) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is (14S)-10-hydroxy-7,7,14,18,20-pentamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicos-19-en-16-one.
| Compound Name | (14S)-10-hydroxy-7,7,14,18,20-pentamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicos-19-en-16-one |
|---|---|
| PubChem CID | 58304661 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | (14S)-10-hydroxy-7,7,14,18,20-pentamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicos-19-en-16-one |
| SMILES | CC1=CC(C)C2C(=O)O[C@@H](C)CCCC(O)C3OC(C)(C)OC3CCCC2C1 |
| InChI | InChI=1S/C23H38O5/c1-14-12-15(2)20-17(13-14)9-7-11-19-21(28-23(4,5)27-19)18(24)10-6-8-16(3)26-22(20)25/h12,15-21,24H,6-11,13H2,1-5H3/t15?,16-,17?,18?,19?,20?,21?/m0/s1 |
| InChIKey | LLUPTCUHRZOOJH-FSKQPPNESA-N |
| XLogP | 4.37 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|