About (4E,7Z)-5-fluoro-2-methylundeca-4,7-dien-6-ol
(4E,7Z)-5-fluoro-2-methylundeca-4,7-dien-6-ol (PubChem CID 58304685) has the molecular formula C12H21FO
and a molecular weight of 200.30 g/mol. Its IUPAC name is (4E,7Z)-5-fluoro-2-methylundeca-4,7-dien-6-ol.
Molecular Properties
| Compound Name | (4E,7Z)-5-fluoro-2-methylundeca-4,7-dien-6-ol |
| PubChem CID | 58304685 |
| Molecular Formula | C12H21FO |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | (4E,7Z)-5-fluoro-2-methylundeca-4,7-dien-6-ol |
| SMILES | CCC/C=C\C(O)/C(F)=C\CC(C)C |
| InChI | InChI=1S/C12H21FO/c1-4-5-6-7-12(14)11(13)9-8-10(2)3/h6-7,9-10,12,14H,4-5,8H2,1-3H3/b7-6-,11-9+ |
| InChIKey | NURHUXUQJUACHV-SXWITGCCSA-N |
| XLogP | 3.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4E,7Z)-5-fluoro-2-methylundeca-4,7-dien-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,7Z)-5-fluoro-2-methylundeca-4,7-dien-6-ol?
The IUPAC name of (4E,7Z)-5-fluoro-2-methylundeca-4,7-dien-6-ol (CID 58304685) is (4E,7Z)-5-fluoro-2-methylundeca-4,7-dien-6-ol.
What is the SMILES notation for (4E,7Z)-5-fluoro-2-methylundeca-4,7-dien-6-ol?
The canonical SMILES for (4E,7Z)-5-fluoro-2-methylundeca-4,7-dien-6-ol is CCC/C=C\C(O)/C(F)=C\CC(C)C.
What is the InChIKey of (4E,7Z)-5-fluoro-2-methylundeca-4,7-dien-6-ol?
The InChIKey is NURHUXUQJUACHV-SXWITGCCSA-N. The full InChI is InChI=1S/C12H21FO/c1-4-5-6-7-12(14)11(13)9-8-10(2)3/h6-7,9-10,12,14H,4-5,8H2,1-3H3/b7-6-,11-9+.
What are the key properties of (4E,7Z)-5-fluoro-2-methylundeca-4,7-dien-6-ol?
(4E,7Z)-5-fluoro-2-methylundeca-4,7-dien-6-ol has a molecular weight of 200.30 g/mol, XLogP of 3.60, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,7Z)-5-fluoro-2-methylundeca-4,7-dien-6-ol is sourced from PubChem (CID 58304685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).