C24H30O5 — CID 58304724
(6S,10S,12Z,15S)-8,8,15,19,21-pentamethyl-7,9,16-trioxatetracyclo[16.4.0.02,4.06,10]docosa-1(22),12,18,20-tetraene-11,17-dione (PubChem CID 58304724) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is (6S,10S,12Z,15S)-8,8,15,19,21-pentamethyl-7,9,16-trioxatetracyclo[16.4.0.02,4.06,10]docosa-1(22),12,18,20-tetraene-11,17-dione.
| Compound Name | (6S,10S,12Z,15S)-8,8,15,19,21-pentamethyl-7,9,16-trioxatetracyclo[16.4.0.02,4.06,10]docosa-1(22),12,18,20-tetraene-11,17-dione |
|---|---|
| PubChem CID | 58304724 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | (6S,10S,12Z,15S)-8,8,15,19,21-pentamethyl-7,9,16-trioxatetracyclo[16.4.0.02,4.06,10]docosa-1(22),12,18,20-tetraene-11,17-dione |
| SMILES | Cc1cc(C)c2c(c1)C1CC1C[C@@H]1OC(C)(C)O[C@@H]1C(=O)/C=C\C[C@H](C)OC2=O |
| InChI | InChI=1S/C24H30O5/c1-13-9-14(2)21-18(10-13)17-11-16(17)12-20-22(29-24(4,5)28-20)19(25)8-6-7-15(3)27-23(21)26/h6,8-10,15-17,20,22H,7,11-12H2,1-5H3/b8-6-/t15-,16?,17?,20-,22+/m0/s1 |
| InChIKey | JFCCIFCBQLQTMN-OBZLVKAASA-N |
| XLogP | 4.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |