C21H40O4Si — CID 58304756
(4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-2,2-dimethyl-5-propyl-1,3-dioxolan-4-yl]-4-methylhex-2-yn-1-ol (PubChem CID 58304756) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is (4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-2,2-dimethyl-5-propyl-1,3-dioxolan-4-yl]-4-methylhex-2-yn-1-ol.
| Compound Name | (4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-2,2-dimethyl-5-propyl-1,3-dioxolan-4-yl]-4-methylhex-2-yn-1-ol |
|---|---|
| PubChem CID | 58304756 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | (4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-2,2-dimethyl-5-propyl-1,3-dioxolan-4-yl]-4-methylhex-2-yn-1-ol |
| SMILES | CCC[C@@H]1OC(C)(C)O[C@@H]1C(O)C#C[C@@H](C)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O4Si/c1-11-12-18-19(24-21(7,8)23-18)17(22)14-13-15(2)16(3)25-26(9,10)20(4,5)6/h15-19,22H,11-12H2,1-10H3/t15-,16+,17?,18+,19-/m1/s1 |
| InChIKey | GPXYSABXZHVNAP-ROGNRFNYSA-N |
| XLogP | 4.72 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|