C23H28FNO6 — CID 58304814
(2E,5S,9S,11E,13R,14S)-11-fluoro-18-hydroxy-7,7,13,14-tetramethyl-20-(methylamino)-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaene-10,16-dione (PubChem CID 58304814) has the molecular formula C23H28FNO6 and a molecular weight of 433.48 g/mol. Its IUPAC name is (2E,5S,9S,11E,13R,14S)-11-fluoro-18-hydroxy-7,7,13,14-tetramethyl-20-(methylamino)-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaene-10,16-dione.
| Compound Name | (2E,5S,9S,11E,13R,14S)-11-fluoro-18-hydroxy-7,7,13,14-tetramethyl-20-(methylamino)-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaene-10,16-dione |
|---|---|
| PubChem CID | 58304814 |
| Molecular Formula | C23H28FNO6 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (2E,5S,9S,11E,13R,14S)-11-fluoro-18-hydroxy-7,7,13,14-tetramethyl-20-(methylamino)-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaene-10,16-dione |
| SMILES | CNc1cc(O)c2c(c1)/C=C/C[C@@H]1OC(C)(C)O[C@@H]1C(=O)/C(F)=C\[C@@H](C)[C@H](C)OC2=O |
| InChI | InChI=1S/C23H28FNO6/c1-12-9-16(24)20(27)21-18(30-23(3,4)31-21)8-6-7-14-10-15(25-5)11-17(26)19(14)22(28)29-13(12)2/h6-7,9-13,18,21,25-26H,8H2,1-5H3/b7-6+,16-9+/t12-,13+,18+,21+/m1/s1 |
| InChIKey | AXAAVZMVVPVSRK-GZQSOHIASA-N |
| XLogP | 3.97 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|