C16H29IO3 — CID 58304834
(4S,5R)-4-(2-iodoethyl)-5-[(Z,5S)-5-methoxy-6-methylhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 58304834) has the molecular formula C16H29IO3 and a molecular weight of 396.31 g/mol. Its IUPAC name is (4S,5R)-4-(2-iodoethyl)-5-[(Z,5S)-5-methoxy-6-methylhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S,5R)-4-(2-iodoethyl)-5-[(Z,5S)-5-methoxy-6-methylhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 58304834 |
| Molecular Formula | C16H29IO3 |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | (4S,5R)-4-(2-iodoethyl)-5-[(Z,5S)-5-methoxy-6-methylhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CO[C@H](/C=C\C(C)[C@H]1OC(C)(C)O[C@H]1CCI)C(C)C |
| InChI | InChI=1S/C16H29IO3/c1-11(2)13(18-6)8-7-12(3)15-14(9-10-17)19-16(4,5)20-15/h7-8,11-15H,9-10H2,1-6H3/b8-7-/t12?,13-,14+,15-/m1/s1 |
| InChIKey | AVRAYRMFUONZNR-BHJQGOKGSA-N |
| XLogP | 4.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|