C21H25N3O7 — CID 58304852
(4S,5S,6Z,9S,10S,12E)-16-(2-azidoethoxy)-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione (PubChem CID 58304852) has the molecular formula C21H25N3O7 and a molecular weight of 431.45 g/mol. Its IUPAC name is (4S,5S,6Z,9S,10S,12E)-16-(2-azidoethoxy)-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione.
| Compound Name | (4S,5S,6Z,9S,10S,12E)-16-(2-azidoethoxy)-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
|---|---|
| PubChem CID | 58304852 |
| Molecular Formula | C21H25N3O7 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | (4S,5S,6Z,9S,10S,12E)-16-(2-azidoethoxy)-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
| SMILES | C[C@@H]1OC(=O)c2c(O)cc(OCCN=[N+]=[N-])cc2/C=C/C[C@H](O)[C@H](O)C(=O)/C=C\[C@@H]1C |
| InChI | InChI=1S/C21H25N3O7/c1-12-6-7-17(26)20(28)16(25)5-3-4-14-10-15(30-9-8-23-24-22)11-18(27)19(14)21(29)31-13(12)2/h3-4,6-7,10-13,16,20,25,27-28H,5,8-9H2,1-2H3/b4-3+,7-6-/t12-,13-,16-,20-/m0/s1 |
| InChIKey | XITBTEJOKKQRFK-SJZAOGFMSA-N |
| XLogP | 2.53 |
| TPSA | 162.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|