C24H27F3O5 — CID 58304862
(2E,11Z)-7,7,14,18,20-pentamethyl-13-(trifluoromethyl)-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaene-10,16-dione (PubChem CID 58304862) has the molecular formula C24H27F3O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is (2E,11Z)-7,7,14,18,20-pentamethyl-13-(trifluoromethyl)-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaene-10,16-dione.
| Compound Name | (2E,11Z)-7,7,14,18,20-pentamethyl-13-(trifluoromethyl)-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaene-10,16-dione |
|---|---|
| PubChem CID | 58304862 |
| Molecular Formula | C24H27F3O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | (2E,11Z)-7,7,14,18,20-pentamethyl-13-(trifluoromethyl)-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaene-10,16-dione |
| SMILES | Cc1cc(C)c2c(c1)/C=C/CC1OC(C)(C)OC1C(=O)/C=C\C(C(F)(F)F)C(C)OC2=O |
| InChI | InChI=1S/C24H27F3O5/c1-13-11-14(2)20-16(12-13)7-6-8-19-21(32-23(4,5)31-19)18(28)10-9-17(24(25,26)27)15(3)30-22(20)29/h6-7,9-12,15,17,19,21H,8H2,1-5H3/b7-6+,10-9- |
| InChIKey | JRLLAXDAEBSWNN-KQHSAVHASA-N |
| XLogP | 5.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |