C20H39IO3Si — CID 58304875
tert-butyl-[(Z)-1-[(4S,5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methylhex-2-enoxy]-dimethylsilane (PubChem CID 58304875) has the molecular formula C20H39IO3Si and a molecular weight of 482.52 g/mol. Its IUPAC name is tert-butyl-[(Z)-1-[(4S,5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methylhex-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z)-1-[(4S,5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methylhex-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 58304875 |
| Molecular Formula | C20H39IO3Si |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | tert-butyl-[(Z)-1-[(4S,5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methylhex-2-enoxy]-dimethylsilane |
| SMILES | CC(C)C/C=C\C(O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@H]1CCI |
| InChI | InChI=1S/C20H39IO3Si/c1-15(2)11-10-12-17(24-25(8,9)19(3,4)5)18-16(13-14-21)22-20(6,7)23-18/h10,12,15-18H,11,13-14H2,1-9H3/b12-10-/t16-,17?,18-/m0/s1 |
| InChIKey | PFUMIIKOUVBFFW-BEDOKAMBSA-N |
| XLogP | 6.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|