C21H41IO3Si — CID 58304886
tert-butyl-[(Z)-1-[(4S,5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,5-dimethylhex-2-enoxy]-dimethylsilane (PubChem CID 58304886) has the molecular formula C21H41IO3Si and a molecular weight of 496.55 g/mol. Its IUPAC name is tert-butyl-[(Z)-1-[(4S,5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,5-dimethylhex-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z)-1-[(4S,5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,5-dimethylhex-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 58304886 |
| Molecular Formula | C21H41IO3Si |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | tert-butyl-[(Z)-1-[(4S,5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,5-dimethylhex-2-enoxy]-dimethylsilane |
| SMILES | C/C(=C/C(O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@H]1CCI)CC(C)C |
| InChI | InChI=1S/C21H41IO3Si/c1-15(2)13-16(3)14-18(25-26(9,10)20(4,5)6)19-17(11-12-22)23-21(7,8)24-19/h14-15,17-19H,11-13H2,1-10H3/b16-14-/t17-,18?,19-/m0/s1 |
| InChIKey | ZWOWXNHYISQMEH-BIDCPBLHSA-N |
| XLogP | 6.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|