C17H31O4P — CID 58304902
2-[(4S,5R)-5-[(Z,5S,6R)-7-methoxyphosphanyl-5,6-dimethylhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde (PubChem CID 58304902) has the molecular formula C17H31O4P and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-[(4S,5R)-5-[(Z,5S,6R)-7-methoxyphosphanyl-5,6-dimethylhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde.
| Compound Name | 2-[(4S,5R)-5-[(Z,5S,6R)-7-methoxyphosphanyl-5,6-dimethylhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 58304902 |
| Molecular Formula | C17H31O4P |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 2-[(4S,5R)-5-[(Z,5S,6R)-7-methoxyphosphanyl-5,6-dimethylhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
| SMILES | COPC[C@H](C)[C@@H](C)/C=C\C(C)[C@H]1OC(C)(C)O[C@H]1CC=O |
| InChI | InChI=1S/C17H31O4P/c1-12(14(3)11-22-19-6)7-8-13(2)16-15(9-10-18)20-17(4,5)21-16/h7-8,10,12-16,22H,9,11H2,1-6H3/b8-7-/t12-,13?,14-,15-,16+/m0/s1 |
| InChIKey | IDXOADKCMPKDAM-WDKRHZSWSA-N |
| XLogP | 3.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|