C24H30FNO6 — CID 58304963
(4S,5S,6E,9S,10S,12E)-7-fluoro-9,10,18-trihydroxy-4,5-dimethyl-16-piperidin-1-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione (PubChem CID 58304963) has the molecular formula C24H30FNO6 and a molecular weight of 447.50 g/mol. Its IUPAC name is (4S,5S,6E,9S,10S,12E)-7-fluoro-9,10,18-trihydroxy-4,5-dimethyl-16-piperidin-1-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione.
| Compound Name | (4S,5S,6E,9S,10S,12E)-7-fluoro-9,10,18-trihydroxy-4,5-dimethyl-16-piperidin-1-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
|---|---|
| PubChem CID | 58304963 |
| Molecular Formula | C24H30FNO6 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | (4S,5S,6E,9S,10S,12E)-7-fluoro-9,10,18-trihydroxy-4,5-dimethyl-16-piperidin-1-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
| SMILES | C[C@@H]1OC(=O)c2c(O)cc(N3CCCCC3)cc2/C=C/C[C@H](O)[C@H](O)C(=O)/C(F)=C\[C@@H]1C |
| InChI | InChI=1S/C24H30FNO6/c1-14-11-18(25)22(29)23(30)19(27)8-6-7-16-12-17(26-9-4-3-5-10-26)13-20(28)21(16)24(31)32-15(14)2/h6-7,11-15,19,23,27-28,30H,3-5,8-10H2,1-2H3/b7-6+,18-11+/t14-,15-,19-,23-/m0/s1 |
| InChIKey | HNDMVAJHEHDYRB-NRVDWTPZSA-N |
| XLogP | 3.13 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|