C21H22O7 — CID 58304979
(4S,5S,6Z,9S,10S,12E)-9,10,21-trihydroxy-4,5-dimethyl-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),6,12,15(19),16,20-hexaene-2,8-dione (PubChem CID 58304979) has the molecular formula C21H22O7 and a molecular weight of 386.40 g/mol. Its IUPAC name is (4S,5S,6Z,9S,10S,12E)-9,10,21-trihydroxy-4,5-dimethyl-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),6,12,15(19),16,20-hexaene-2,8-dione.
| Compound Name | (4S,5S,6Z,9S,10S,12E)-9,10,21-trihydroxy-4,5-dimethyl-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),6,12,15(19),16,20-hexaene-2,8-dione |
|---|---|
| PubChem CID | 58304979 |
| Molecular Formula | C21H22O7 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (4S,5S,6Z,9S,10S,12E)-9,10,21-trihydroxy-4,5-dimethyl-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),6,12,15(19),16,20-hexaene-2,8-dione |
| SMILES | C[C@@H]1OC(=O)c2c(O)cc3occc3c2/C=C/C[C@H](O)[C@H](O)C(=O)/C=C\[C@@H]1C |
| InChI | InChI=1S/C21H22O7/c1-11-6-7-16(23)20(25)15(22)5-3-4-14-13-8-9-27-18(13)10-17(24)19(14)21(26)28-12(11)2/h3-4,6-12,15,20,22,24-25H,5H2,1-2H3/b4-3+,7-6-/t11-,12-,15-,20-/m0/s1 |
| InChIKey | MKUADGGFOMIABJ-VYNOMOSCSA-N |
| XLogP | 2.58 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |