C23H26O7 — CID 58305029
(4S,5S,6Z,9S,10S,12E)-17-ethyl-9,10,21-trihydroxy-4,5-dimethyl-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),6,12,15(19),16,20-hexaene-2,8-dione (PubChem CID 58305029) has the molecular formula C23H26O7 and a molecular weight of 414.45 g/mol. Its IUPAC name is (4S,5S,6Z,9S,10S,12E)-17-ethyl-9,10,21-trihydroxy-4,5-dimethyl-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),6,12,15(19),16,20-hexaene-2,8-dione.
| Compound Name | (4S,5S,6Z,9S,10S,12E)-17-ethyl-9,10,21-trihydroxy-4,5-dimethyl-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),6,12,15(19),16,20-hexaene-2,8-dione |
|---|---|
| PubChem CID | 58305029 |
| Molecular Formula | C23H26O7 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (4S,5S,6Z,9S,10S,12E)-17-ethyl-9,10,21-trihydroxy-4,5-dimethyl-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),6,12,15(19),16,20-hexaene-2,8-dione |
| SMILES | CCc1cc2c3c(c(O)cc2o1)C(=O)O[C@@H](C)[C@@H](C)/C=C\C(=O)[C@@H](O)[C@@H](O)C/C=C/3 |
| InChI | InChI=1S/C23H26O7/c1-4-14-10-16-15-6-5-7-17(24)22(27)18(25)9-8-12(2)13(3)29-23(28)21(15)19(26)11-20(16)30-14/h5-6,8-13,17,22,24,26-27H,4,7H2,1-3H3/b6-5+,9-8-/t12-,13-,17-,22-/m0/s1 |
| InChIKey | HCMCEWOCHKMPRW-KPGGQYQLSA-N |
| XLogP | 3.15 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |