C28H44O8Si — CID 58305088
2-[(E)-3-[(4S,5R)-5-[(Z)-6-hydroxyhex-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-6-(methoxymethoxy)-4-(2-trimethylsilylethoxy)benzoic acid (PubChem CID 58305088) has the molecular formula C28H44O8Si and a molecular weight of 536.74 g/mol. Its IUPAC name is 2-[(E)-3-[(4S,5R)-5-[(Z)-6-hydroxyhex-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-6-(methoxymethoxy)-4-(2-trimethylsilylethoxy)benzoic acid.
| Compound Name | 2-[(E)-3-[(4S,5R)-5-[(Z)-6-hydroxyhex-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-6-(methoxymethoxy)-4-(2-trimethylsilylethoxy)benzoic acid |
|---|---|
| PubChem CID | 58305088 |
| Molecular Formula | C28H44O8Si |
| Molecular Weight | 536.74 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | 2-[(E)-3-[(4S,5R)-5-[(Z)-6-hydroxyhex-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-6-(methoxymethoxy)-4-(2-trimethylsilylethoxy)benzoic acid |
| SMILES | COCOc1cc(OCC[Si](C)(C)C)cc(/C=C/C[C@@H]2OC(C)(C)O[C@@H]2C(C)/C=C\CCO)c1C(=O)O |
| InChI | InChI=1S/C28H44O8Si/c1-20(11-8-9-14-29)26-23(35-28(2,3)36-26)13-10-12-21-17-22(33-15-16-37(5,6)7)18-24(34-19-32-4)25(21)27(30)31/h8,10-12,17-18,20,23,26,29H,9,13-16,19H2,1-7H3,(H,30,31)/b11-8-,12-10+/t20?,23-,26+/m0/s1 |
| InChIKey | XHLAVMRPYCGNTK-QPWCBBPGSA-N |
| XLogP | 5.58 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.74 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|