About (E,3S)-5-fluoro-2,3-dimethylundec-4-en-7-yn-6-ol
(E,3S)-5-fluoro-2,3-dimethylundec-4-en-7-yn-6-ol (PubChem CID 58305109) has the molecular formula C13H21FO
and a molecular weight of 212.31 g/mol. Its IUPAC name is (E,3S)-5-fluoro-2,3-dimethylundec-4-en-7-yn-6-ol.
Molecular Properties
| Compound Name | (E,3S)-5-fluoro-2,3-dimethylundec-4-en-7-yn-6-ol |
| PubChem CID | 58305109 |
| Molecular Formula | C13H21FO |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | (E,3S)-5-fluoro-2,3-dimethylundec-4-en-7-yn-6-ol |
| SMILES | CCCC#CC(O)/C(F)=C\[C@@H](C)C(C)C |
| InChI | InChI=1S/C13H21FO/c1-5-6-7-8-13(15)12(14)9-11(4)10(2)3/h9-11,13,15H,5-6H2,1-4H3/b12-9+/t11-,13?/m1/s1 |
| InChIKey | FPNCBZRDDWPFPP-QRRAVOKXSA-N |
| XLogP | 3.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E,3S)-5-fluoro-2,3-dimethylundec-4-en-7-yn-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,3S)-5-fluoro-2,3-dimethylundec-4-en-7-yn-6-ol?
The IUPAC name of (E,3S)-5-fluoro-2,3-dimethylundec-4-en-7-yn-6-ol (CID 58305109) is (E,3S)-5-fluoro-2,3-dimethylundec-4-en-7-yn-6-ol.
What is the SMILES notation for (E,3S)-5-fluoro-2,3-dimethylundec-4-en-7-yn-6-ol?
The canonical SMILES for (E,3S)-5-fluoro-2,3-dimethylundec-4-en-7-yn-6-ol is CCCC#CC(O)/C(F)=C\[C@@H](C)C(C)C.
What is the InChIKey of (E,3S)-5-fluoro-2,3-dimethylundec-4-en-7-yn-6-ol?
The InChIKey is FPNCBZRDDWPFPP-QRRAVOKXSA-N. The full InChI is InChI=1S/C13H21FO/c1-5-6-7-8-13(15)12(14)9-11(4)10(2)3/h9-11,13,15H,5-6H2,1-4H3/b12-9+/t11-,13?/m1/s1.
What are the key properties of (E,3S)-5-fluoro-2,3-dimethylundec-4-en-7-yn-6-ol?
(E,3S)-5-fluoro-2,3-dimethylundec-4-en-7-yn-6-ol has a molecular weight of 212.31 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E,3S)-5-fluoro-2,3-dimethylundec-4-en-7-yn-6-ol is sourced from PubChem (CID 58305109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).