C23H27FO5 — CID 58305118
(2E,5S,9S,11Z,13R,14S)-21-fluoro-7,7,13,14,18-pentamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaene-10,16-dione (PubChem CID 58305118) has the molecular formula C23H27FO5 and a molecular weight of 402.46 g/mol. Its IUPAC name is (2E,5S,9S,11Z,13R,14S)-21-fluoro-7,7,13,14,18-pentamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaene-10,16-dione.
| Compound Name | (2E,5S,9S,11Z,13R,14S)-21-fluoro-7,7,13,14,18-pentamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaene-10,16-dione |
|---|---|
| PubChem CID | 58305118 |
| Molecular Formula | C23H27FO5 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (2E,5S,9S,11Z,13R,14S)-21-fluoro-7,7,13,14,18-pentamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaene-10,16-dione |
| SMILES | Cc1ccc(F)c2c1C(=O)O[C@@H](C)[C@H](C)/C=C\C(=O)[C@H]1OC(C)(C)O[C@H]1C/C=C/2 |
| InChI | InChI=1S/C23H27FO5/c1-13-10-12-18(25)21-19(28-23(4,5)29-21)8-6-7-16-17(24)11-9-14(2)20(16)22(26)27-15(13)3/h6-7,9-13,15,19,21H,8H2,1-5H3/b7-6+,12-10-/t13-,15+,19+,21-/m1/s1 |
| InChIKey | CDDPNDKUJQISPG-UUJHHNJCSA-N |
| XLogP | 4.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |