About 4-(2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)morpholine
4-(2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)morpholine (PubChem CID 58305220) has the molecular formula C11H13N3OS
and a molecular weight of 235.31 g/mol. Its IUPAC name is 4-(2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)morpholine.
Molecular Properties
| Compound Name | 4-(2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)morpholine |
| PubChem CID | 58305220 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 4-(2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)morpholine |
| SMILES | Cc1nc2ccc(N3CCOCC3)nc2s1 |
| InChI | InChI=1S/C11H13N3OS/c1-8-12-9-2-3-10(13-11(9)16-8)14-4-6-15-7-5-14/h2-3H,4-7H2,1H3 |
| InChIKey | VUKWRDMATUWHOJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)morpholine?
The IUPAC name of 4-(2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)morpholine (CID 58305220) is 4-(2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)morpholine.
What is the SMILES notation for 4-(2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)morpholine?
The canonical SMILES for 4-(2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)morpholine is Cc1nc2ccc(N3CCOCC3)nc2s1.
What is the InChIKey of 4-(2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)morpholine?
The InChIKey is VUKWRDMATUWHOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3OS/c1-8-12-9-2-3-10(13-11(9)16-8)14-4-6-15-7-5-14/h2-3H,4-7H2,1H3.
What are the key properties of 4-(2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)morpholine?
4-(2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)morpholine has a molecular weight of 235.31 g/mol, XLogP of 1.84, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)morpholine is sourced from PubChem (CID 58305220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).