C27H36F3N3O3 — CID 58305870
[(1S,4S)-4-[[(3S,4S)-3-methoxyoxan-4-yl]methyl]-1-propan-2-ylcyclopent-2-en-1-yl]-[(1R,4R)-5-[4-(trifluoromethyl)-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone (PubChem CID 58305870) has the molecular formula C27H36F3N3O3 and a molecular weight of 507.60 g/mol. Its IUPAC name is [(1S,4S)-4-[[(3S,4S)-3-methoxyoxan-4-yl]methyl]-1-propan-2-ylcyclopent-2-en-1-yl]-[(1R,4R)-5-[4-(trifluoromethyl)-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone.
| Compound Name | [(1S,4S)-4-[[(3S,4S)-3-methoxyoxan-4-yl]methyl]-1-propan-2-ylcyclopent-2-en-1-yl]-[(1R,4R)-5-[4-(trifluoromethyl)-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone |
|---|---|
| PubChem CID | 58305870 |
| Molecular Formula | C27H36F3N3O3 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | [(1S,4S)-4-[[(3S,4S)-3-methoxyoxan-4-yl]methyl]-1-propan-2-ylcyclopent-2-en-1-yl]-[(1R,4R)-5-[4-(trifluoromethyl)-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone |
| SMILES | CO[C@@H]1COCC[C@@H]1C[C@@H]1C=C[C@@](C(=O)N2C[C@H]3C[C@@H]2CN3c2cc(C(F)(F)F)ccn2)(C(C)C)C1 |
| InChI | InChI=1S/C27H36F3N3O3/c1-17(2)26(7-4-18(13-26)10-19-6-9-36-16-23(19)35-3)25(34)33-15-21-12-22(33)14-32(21)24-11-20(5-8-31-24)27(28,29)30/h4-5,7-8,11,17-19,21-23H,6,9-10,12-16H2,1-3H3/t18-,19+,21+,22+,23+,26-/m0/s1 |
| InChIKey | XUHHKHDKVDQGAN-NQMANDJFSA-N |
| XLogP | 4.55 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|