C26H36F3N3O3 — CID 58305884
[(1S,3S)-1-ethyl-3-[[(3S,4S)-3-methoxyoxan-4-yl]methyl]cyclopentyl]-[(1R,4R)-5-[4-(trifluoromethyl)-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone (PubChem CID 58305884) has the molecular formula C26H36F3N3O3 and a molecular weight of 495.59 g/mol. Its IUPAC name is [(1S,3S)-1-ethyl-3-[[(3S,4S)-3-methoxyoxan-4-yl]methyl]cyclopentyl]-[(1R,4R)-5-[4-(trifluoromethyl)-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone.
| Compound Name | [(1S,3S)-1-ethyl-3-[[(3S,4S)-3-methoxyoxan-4-yl]methyl]cyclopentyl]-[(1R,4R)-5-[4-(trifluoromethyl)-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone |
|---|---|
| PubChem CID | 58305884 |
| Molecular Formula | C26H36F3N3O3 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | [(1S,3S)-1-ethyl-3-[[(3S,4S)-3-methoxyoxan-4-yl]methyl]cyclopentyl]-[(1R,4R)-5-[4-(trifluoromethyl)-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone |
| SMILES | CC[C@]1(C(=O)N2C[C@H]3C[C@@H]2CN3c2cc(C(F)(F)F)ccn2)CC[C@@H](C[C@H]2CCOC[C@H]2OC)C1 |
| InChI | InChI=1S/C26H36F3N3O3/c1-3-25(7-4-17(13-25)10-18-6-9-35-16-22(18)34-2)24(33)32-15-20-12-21(32)14-31(20)23-11-19(5-8-30-23)26(27,28)29/h5,8,11,17-18,20-22H,3-4,6-7,9-10,12-16H2,1-2H3/t17-,18+,20+,21+,22+,25-/m0/s1 |
| InChIKey | FFGQSPAUUOQBIV-HUABEJAVSA-N |
| XLogP | 4.53 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |