About 2-tert-butyl-4-(1,1-difluoroethyl)-3,5-difluoropyridine
2-tert-butyl-4-(1,1-difluoroethyl)-3,5-difluoropyridine (PubChem CID 58305903) has the molecular formula C11H13F4N
and a molecular weight of 235.22 g/mol. Its IUPAC name is 2-tert-butyl-4-(1,1-difluoroethyl)-3,5-difluoropyridine.
Molecular Properties
| Compound Name | 2-tert-butyl-4-(1,1-difluoroethyl)-3,5-difluoropyridine |
| PubChem CID | 58305903 |
| Molecular Formula | C11H13F4N |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-tert-butyl-4-(1,1-difluoroethyl)-3,5-difluoropyridine |
| SMILES | CC(C)(C)c1ncc(F)c(C(C)(F)F)c1F |
| InChI | InChI=1S/C11H13F4N/c1-10(2,3)9-8(13)7(11(4,14)15)6(12)5-16-9/h5H,1-4H3 |
| InChIKey | FOKRQESFJPVHMT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butyl-4-(1,1-difluoroethyl)-3,5-difluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4-(1,1-difluoroethyl)-3,5-difluoropyridine?
The IUPAC name of 2-tert-butyl-4-(1,1-difluoroethyl)-3,5-difluoropyridine (CID 58305903) is 2-tert-butyl-4-(1,1-difluoroethyl)-3,5-difluoropyridine.
What is the SMILES notation for 2-tert-butyl-4-(1,1-difluoroethyl)-3,5-difluoropyridine?
The canonical SMILES for 2-tert-butyl-4-(1,1-difluoroethyl)-3,5-difluoropyridine is CC(C)(C)c1ncc(F)c(C(C)(F)F)c1F.
What is the InChIKey of 2-tert-butyl-4-(1,1-difluoroethyl)-3,5-difluoropyridine?
The InChIKey is FOKRQESFJPVHMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F4N/c1-10(2,3)9-8(13)7(11(4,14)15)6(12)5-16-9/h5H,1-4H3.
What are the key properties of 2-tert-butyl-4-(1,1-difluoroethyl)-3,5-difluoropyridine?
2-tert-butyl-4-(1,1-difluoroethyl)-3,5-difluoropyridine has a molecular weight of 235.22 g/mol, XLogP of 3.77, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4-(1,1-difluoroethyl)-3,5-difluoropyridine is sourced from PubChem (CID 58305903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).